C21H28FNO4S — CID 18797878
(E)-7-[2-[[(E)-2-(3-fluorophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid (PubChem CID 18797878) has the molecular formula C21H28FNO4S and a molecular weight of 409.52 g/mol. Its IUPAC name is (E)-7-[2-[[(E)-2-(3-fluorophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[[(E)-2-(3-fluorophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 18797878 |
| Molecular Formula | C21H28FNO4S |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (E)-7-[2-[[(E)-2-(3-fluorophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1CCCCC1NS(=O)(=O)/C=C/c1cccc(F)c1 |
| InChI | InChI=1S/C21H28FNO4S/c22-19-11-7-8-17(16-19)14-15-28(26,27)23-20-12-6-5-10-18(20)9-3-1-2-4-13-21(24)25/h1,3,7-8,11,14-16,18,20,23H,2,4-6,9-10,12-13H2,(H,24,25)/b3-1+,15-14+ |
| InChIKey | QWMPMNJAFYDTED-ONEZXHGESA-N |
| XLogP | 4.48 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|