C21H28BrNO4S — CID 18798024
(E)-7-[2-[[(E)-2-(4-bromophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid (PubChem CID 18798024) has the molecular formula C21H28BrNO4S and a molecular weight of 470.43 g/mol. Its IUPAC name is (E)-7-[2-[[(E)-2-(4-bromophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-[[(E)-2-(4-bromophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 18798024 |
| Molecular Formula | C21H28BrNO4S |
| Molecular Weight | 470.43 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (E)-7-[2-[[(E)-2-(4-bromophenyl)ethenyl]sulfonylamino]cyclohexyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1CCCCC1NS(=O)(=O)/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H28BrNO4S/c22-19-13-11-17(12-14-19)15-16-28(26,27)23-20-9-6-5-8-18(20)7-3-1-2-4-10-21(24)25/h1,3,11-16,18,20,23H,2,4-10H2,(H,24,25)/b3-1+,16-15+ |
| InChIKey | RTEUKEBMKABLRA-QWSXNCAZSA-N |
| XLogP | 5.10 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.43 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|