C22H28INO4S — CID 54400707
6-[6-[2-(4-iodophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid (PubChem CID 54400707) has the molecular formula C22H28INO4S and a molecular weight of 529.44 g/mol. Its IUPAC name is 6-[6-[2-(4-iodophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid.
| Compound Name | 6-[6-[2-(4-iodophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 54400707 |
| Molecular Formula | C22H28INO4S |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 529.08 |
| IUPAC Name | 6-[6-[2-(4-iodophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCCC=CC1CC2CCC1C(NS(=O)(=O)C=Cc1ccc(I)cc1)C2 |
| InChI | InChI=1S/C22H28INO4S/c23-19-9-6-16(7-10-19)12-13-29(27,28)24-21-15-17-8-11-20(21)18(14-17)4-2-1-3-5-22(25)26/h2,4,6-7,9-10,12-13,17-18,20-21,24H,1,3,5,8,11,14-15H2,(H,25,26) |
| InChIKey | VNFQGFAOHBGADB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|