C20H26BrNO4S — CID 54140532
6-[(1R,2R,4S)-6-[(4-bromophenoxy)sulfinylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid (PubChem CID 54140532) has the molecular formula C20H26BrNO4S and a molecular weight of 456.40 g/mol. Its IUPAC name is 6-[(1R,2R,4S)-6-[(4-bromophenoxy)sulfinylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid.
| Compound Name | 6-[(1R,2R,4S)-6-[(4-bromophenoxy)sulfinylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 54140532 |
| Molecular Formula | C20H26BrNO4S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | 6-[(1R,2R,4S)-6-[(4-bromophenoxy)sulfinylamino]-2-bicyclo[2.2.2]octanyl]hex-5-enoic acid |
| SMILES | O=C(O)CCCC=C[C@H]1C[C@@H]2CC[C@H]1C(NS(=O)Oc1ccc(Br)cc1)C2 |
| InChI | InChI=1S/C20H26BrNO4S/c21-16-7-9-17(10-8-16)26-27(25)22-19-13-14-6-11-18(19)15(12-14)4-2-1-3-5-20(23)24/h2,4,7-10,14-15,18-19,22H,1,3,5-6,11-13H2,(H,23,24)/t14-,15-,18+,19?,27?/m0/s1 |
| InChIKey | OATSVPYEZZBHPT-UZTISAGLSA-N |
| XLogP | 4.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|