C23H33NO2 — CID 59956854
(Z)-6-[(1R,6S)-6-[[(2,4,6-trimethylphenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid (PubChem CID 59956854) has the molecular formula C23H33NO2 and a molecular weight of 355.52 g/mol. Its IUPAC name is (Z)-6-[(1R,6S)-6-[[(2,4,6-trimethylphenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,6S)-6-[[(2,4,6-trimethylphenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956854 |
| Molecular Formula | C23H33NO2 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | (Z)-6-[(1R,6S)-6-[[(2,4,6-trimethylphenyl)methylamino]methyl]cyclohex-3-en-1-yl]hex-5-enoic acid |
| SMILES | Cc1cc(C)c(CNC[C@H]2CC=CC[C@@H]2/C=C\CCCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C23H33NO2/c1-17-13-18(2)22(19(3)14-17)16-24-15-21-11-8-7-10-20(21)9-5-4-6-12-23(25)26/h5,7-9,13-14,20-21,24H,4,6,10-12,15-16H2,1-3H3,(H,25,26)/b9-5-/t20-,21+/m0/s1 |
| InChIKey | RQZHPRKYOGFYBZ-HCMBVFRLSA-N |
| XLogP | 5.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|