C23H31BrO2 — CID 59956748
(Z)-6-[(1S,2R,3S,4R)-3-[3-(4-bromo-2-methylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid (PubChem CID 59956748) has the molecular formula C23H31BrO2 and a molecular weight of 419.40 g/mol. Its IUPAC name is (Z)-6-[(1S,2R,3S,4R)-3-[3-(4-bromo-2-methylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1S,2R,3S,4R)-3-[3-(4-bromo-2-methylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 59956748 |
| Molecular Formula | C23H31BrO2 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (Z)-6-[(1S,2R,3S,4R)-3-[3-(4-bromo-2-methylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
| SMILES | Cc1cc(Br)ccc1CCC[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1/C=C\CCCC(=O)O |
| InChI | InChI=1S/C23H31BrO2/c1-16-14-20(24)13-12-17(16)6-5-8-22-19-11-10-18(15-19)21(22)7-3-2-4-9-23(25)26/h3,7,12-14,18-19,21-22H,2,4-6,8-11,15H2,1H3,(H,25,26)/b7-3-/t18-,19+,21-,22-/m0/s1 |
| InChIKey | OTGWFIQOMOOOAW-STUHUOAYSA-N |
| XLogP | 6.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|