C24H33ClO2 — CID 91602449
(Z)-6-[(1R,2R,3S,4S)-3-[3-(4-chloro-2,6-dimethylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid (PubChem CID 91602449) has the molecular formula C24H33ClO2 and a molecular weight of 388.98 g/mol. Its IUPAC name is (Z)-6-[(1R,2R,3S,4S)-3-[3-(4-chloro-2,6-dimethylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,2R,3S,4S)-3-[3-(4-chloro-2,6-dimethylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 91602449 |
| Molecular Formula | C24H33ClO2 |
| Molecular Weight | 388.98 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (Z)-6-[(1R,2R,3S,4S)-3-[3-(4-chloro-2,6-dimethylphenyl)propyl]-2-bicyclo[2.2.1]heptanyl]hex-5-enoic acid |
| SMILES | Cc1cc(Cl)cc(C)c1CCC[C@H]1[C@H]2CC[C@H](C2)[C@@H]1/C=C\CCCC(=O)O |
| InChI | InChI=1S/C24H33ClO2/c1-16-13-20(25)14-17(2)21(16)8-6-9-23-19-12-11-18(15-19)22(23)7-4-3-5-10-24(26)27/h4,7,13-14,18-19,22-23H,3,5-6,8-12,15H2,1-2H3,(H,26,27)/b7-4-/t18-,19+,22+,23+/m1/s1 |
| InChIKey | GPAJFJFYXUKSHC-BWVRTQDZSA-N |
| XLogP | 6.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.98 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|