C19H29NO3 — CID 94966889
6-[4-(2,4,6-trimethylphenyl)butanoylamino]hexanoic acid (PubChem CID 94966889) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 6-[4-(2,4,6-trimethylphenyl)butanoylamino]hexanoic acid.
| Compound Name | 6-[4-(2,4,6-trimethylphenyl)butanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 94966889 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 6-[4-(2,4,6-trimethylphenyl)butanoylamino]hexanoic acid |
| SMILES | Cc1cc(C)c(CCCC(=O)NCCCCCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C19H29NO3/c1-14-12-15(2)17(16(3)13-14)8-7-9-18(21)20-11-6-4-5-10-19(22)23/h12-13H,4-11H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | HHLTZUKHRHYSLY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|