C22H26ClNO4S — CID 54264972
7-[3-[2-(3-chlorophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid (PubChem CID 54264972) has the molecular formula C22H26ClNO4S and a molecular weight of 435.97 g/mol. Its IUPAC name is 7-[3-[2-(3-chlorophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid.
| Compound Name | 7-[3-[2-(3-chlorophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54264972 |
| Molecular Formula | C22H26ClNO4S |
| Molecular Weight | 435.97 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 7-[3-[2-(3-chlorophenyl)ethenylsulfonylamino]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCC1C2C=CC(C2)C1NS(=O)(=O)C=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26ClNO4S/c23-19-7-5-6-16(14-19)12-13-29(27,28)24-22-18-11-10-17(15-18)20(22)8-3-1-2-4-9-21(25)26/h1,3,5-7,10-14,17-18,20,22,24H,2,4,8-9,15H2,(H,25,26) |
| InChIKey | RGCZLCVNVYTAOC-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.97 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|