C11H11ClN2O5S — CID 54448013
2-[2-(3-chlorophenyl)ethenylsulfonylcarbamoylamino]acetic acid (PubChem CID 54448013) has the molecular formula C11H11ClN2O5S and a molecular weight of 318.74 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)ethenylsulfonylcarbamoylamino]acetic acid.
| Compound Name | 2-[2-(3-chlorophenyl)ethenylsulfonylcarbamoylamino]acetic acid |
|---|---|
| PubChem CID | 54448013 |
| Molecular Formula | C11H11ClN2O5S |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 2-[2-(3-chlorophenyl)ethenylsulfonylcarbamoylamino]acetic acid |
| SMILES | O=C(O)CNC(=O)NS(=O)(=O)C=Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O5S/c12-9-3-1-2-8(6-9)4-5-20(18,19)14-11(17)13-7-10(15)16/h1-6H,7H2,(H,15,16)(H2,13,14,17) |
| InChIKey | WSXRWKOYWVYWPU-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |