C16H10ClF4NO3S — CID 69431084
N-[2-(3-chlorophenyl)ethenylsulfonyl]-4-fluoro-2-(trifluoromethyl)benzamide (PubChem CID 69431084) has the molecular formula C16H10ClF4NO3S and a molecular weight of 407.77 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethenylsulfonyl]-4-fluoro-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(3-chlorophenyl)ethenylsulfonyl]-4-fluoro-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69431084 |
| Molecular Formula | C16H10ClF4NO3S |
| Molecular Weight | 407.77 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethenylsulfonyl]-4-fluoro-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NS(=O)(=O)C=Cc1cccc(Cl)c1)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C16H10ClF4NO3S/c17-11-3-1-2-10(8-11)6-7-26(24,25)22-15(23)13-5-4-12(18)9-14(13)16(19,20)21/h1-9H,(H,22,23) |
| InChIKey | WENZWVKQBSQXLM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.77 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |