C26H33NO3S — CID 54211009
7-[(1S,2R,5R)-6,6-dimethyl-3-[(2-methyl-1-benzothiophene-7-carbonyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 54211009) has the molecular formula C26H33NO3S and a molecular weight of 439.62 g/mol. Its IUPAC name is 7-[(1S,2R,5R)-6,6-dimethyl-3-[(2-methyl-1-benzothiophene-7-carbonyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1S,2R,5R)-6,6-dimethyl-3-[(2-methyl-1-benzothiophene-7-carbonyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54211009 |
| Molecular Formula | C26H33NO3S |
| Molecular Weight | 439.62 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | 7-[(1S,2R,5R)-6,6-dimethyl-3-[(2-methyl-1-benzothiophene-7-carbonyl)amino]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | Cc1cc2cccc(C(=O)NC3C[C@H]4C[C@@H]([C@H]3CC=CCCCC(=O)O)C4(C)C)c2s1 |
| InChI | InChI=1S/C26H33NO3S/c1-16-13-17-9-8-11-20(24(17)31-16)25(30)27-22-15-18-14-21(26(18,2)3)19(22)10-6-4-5-7-12-23(28)29/h4,6,8-9,11,13,18-19,21-22H,5,7,10,12,14-15H2,1-3H3,(H,27,30)(H,28,29)/t18-,19-,21+,22?/m1/s1 |
| InChIKey | PVYKEAQUJZKQCW-UDGLRHGWSA-N |
| XLogP | 6.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|