C25H37NO3 — CID 13195677
(Z)-7-[(2S,3S)-3-[[(2S)-2-hydroxy-3-phenylpropyl]amino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 13195677) has the molecular formula C25H37NO3 and a molecular weight of 399.58 g/mol. Its IUPAC name is (Z)-7-[(2S,3S)-3-[[(2S)-2-hydroxy-3-phenylpropyl]amino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2S,3S)-3-[[(2S)-2-hydroxy-3-phenylpropyl]amino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 13195677 |
| Molecular Formula | C25H37NO3 |
| Molecular Weight | 399.58 g/mol |
| Exact Mass | 399.28 |
| IUPAC Name | (Z)-7-[(2S,3S)-3-[[(2S)-2-hydroxy-3-phenylpropyl]amino]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC1(C)C2CC1[C@H](C/C=C\CCCC(=O)O)[C@@H](NC[C@@H](O)Cc1ccccc1)C2 |
| InChI | InChI=1S/C25H37NO3/c1-25(2)19-15-22(25)21(12-8-3-4-9-13-24(28)29)23(16-19)26-17-20(27)14-18-10-6-5-7-11-18/h3,5-8,10-11,19-23,26-27H,4,9,12-17H2,1-2H3,(H,28,29)/b8-3-/t19?,20-,21-,22?,23-/m0/s1 |
| InChIKey | PMGIFUWXEZQNBB-ZGFAOGSJSA-N |
| XLogP | 4.43 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|