C24H33N3O2S — CID 88699333
7-[(2R,3R)-6,6-dimethyl-3-[(phenylcarbamothioylhydrazinylidene)methyl]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 88699333) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is 7-[(2R,3R)-6,6-dimethyl-3-[(phenylcarbamothioylhydrazinylidene)methyl]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(2R,3R)-6,6-dimethyl-3-[(phenylcarbamothioylhydrazinylidene)methyl]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 88699333 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 7-[(2R,3R)-6,6-dimethyl-3-[(phenylcarbamothioylhydrazinylidene)methyl]-2-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC1(C)C2CC1[C@@H](CC=CCCCC(=O)O)[C@H](C=NNC(=S)Nc1ccccc1)C2 |
| InChI | InChI=1S/C24H33N3O2S/c1-24(2)18-14-17(16-25-27-23(30)26-19-10-6-5-7-11-19)20(21(24)15-18)12-8-3-4-9-13-22(28)29/h3,5-8,10-11,16-18,20-21H,4,9,12-15H2,1-2H3,(H,28,29)(H2,26,27,30)/t17-,18?,20-,21?/m0/s1 |
| InChIKey | AVPJXTANOWJMFN-YLJXDBKYSA-N |
| XLogP | 5.46 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|