C20H27NO6 — CID 22613240
(E)-7-[3,5-dihydroxy-2-(phenylcarbamoyloxymethyl)cyclopentyl]hept-5-enoic acid (PubChem CID 22613240) has the molecular formula C20H27NO6 and a molecular weight of 377.44 g/mol. Its IUPAC name is (E)-7-[3,5-dihydroxy-2-(phenylcarbamoyloxymethyl)cyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[3,5-dihydroxy-2-(phenylcarbamoyloxymethyl)cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 22613240 |
| Molecular Formula | C20H27NO6 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | (E)-7-[3,5-dihydroxy-2-(phenylcarbamoyloxymethyl)cyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/CC1C(O)CC(O)C1COC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C20H27NO6/c22-17-12-18(23)16(15(17)10-6-1-2-7-11-19(24)25)13-27-20(26)21-14-8-4-3-5-9-14/h1,3-6,8-9,15-18,22-23H,2,7,10-13H2,(H,21,26)(H,24,25)/b6-1+ |
| InChIKey | AQFLKYWZSOOHDL-LZCJLJQNSA-N |
| XLogP | 2.79 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|