C26H33NO4S — CID 54168155
7-[(1R,3R,5S)-2-[(3-methoxy-1-benzothiophene-7-carbonyl)amino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 54168155) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is 7-[(1R,3R,5S)-2-[(3-methoxy-1-benzothiophene-7-carbonyl)amino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | 7-[(1R,3R,5S)-2-[(3-methoxy-1-benzothiophene-7-carbonyl)amino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54168155 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 7-[(1R,3R,5S)-2-[(3-methoxy-1-benzothiophene-7-carbonyl)amino]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | COc1csc2c(C(=O)NC3[C@H](CC=CCCCC(=O)O)C[C@H]4C[C@@H]3C4(C)C)cccc12 |
| InChI | InChI=1S/C26H33NO4S/c1-26(2)17-13-16(9-6-4-5-7-12-22(28)29)23(20(26)14-17)27-25(30)19-11-8-10-18-21(31-3)15-32-24(18)19/h4,6,8,10-11,15-17,20,23H,5,7,9,12-14H2,1-3H3,(H,27,30)(H,28,29)/t16-,17+,20+,23?/m1/s1 |
| InChIKey | OTCFDTQWSOTTBL-KOWCTCFKSA-N |
| XLogP | 5.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|