C25H44O3 — CID 59915121
(Z)-8-[(1R,2R,5R)-3-[(3S)-3-hydroxyoctyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]oct-6-enoic acid (PubChem CID 59915121) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is (Z)-8-[(1R,2R,5R)-3-[(3S)-3-hydroxyoctyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]oct-6-enoic acid.
| Compound Name | (Z)-8-[(1R,2R,5R)-3-[(3S)-3-hydroxyoctyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]oct-6-enoic acid |
|---|---|
| PubChem CID | 59915121 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | (Z)-8-[(1R,2R,5R)-3-[(3S)-3-hydroxyoctyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]oct-6-enoic acid |
| SMILES | CCCCC[C@H](O)CCC1C[C@@H]2C[C@H]([C@@H]1C/C=C\CCCCC(=O)O)C2(C)C |
| InChI | InChI=1S/C25H44O3/c1-4-5-9-12-21(26)16-15-19-17-20-18-23(25(20,2)3)22(19)13-10-7-6-8-11-14-24(27)28/h7,10,19-23,26H,4-6,8-9,11-18H2,1-3H3,(H,27,28)/b10-7-/t19?,20-,21+,22-,23-/m1/s1 |
| InChIKey | ANZPGTPIYVKVMH-PCVLXEPUSA-N |
| XLogP | 6.60 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|