C24H42O2 — CID 10172424
(E)-1-[2-[(E)-7-hydroxyhept-2-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]oct-1-en-3-ol (PubChem CID 10172424) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is (E)-1-[2-[(E)-7-hydroxyhept-2-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]oct-1-en-3-ol.
| Compound Name | (E)-1-[2-[(E)-7-hydroxyhept-2-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 10172424 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | (E)-1-[2-[(E)-7-hydroxyhept-2-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]oct-1-en-3-ol |
| SMILES | CCCCCC(O)/C=C/C1CC2CC(C1C/C=C/CCCCO)C2(C)C |
| InChI | InChI=1S/C24H42O2/c1-4-5-9-12-21(26)15-14-19-17-20-18-23(24(20,2)3)22(19)13-10-7-6-8-11-16-25/h7,10,14-15,19-23,25-26H,4-6,8-9,11-13,16-18H2,1-3H3/b10-7+,15-14+ |
| InChIKey | FAHFOJFOFVXQAX-YFLNMOBYSA-N |
| XLogP | 5.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|