C22H40O4 — CID 91151253
1-[2-(7-hydroxyhept-2-enyl)-3,5-dimethoxycyclopentyl]oct-1-en-3-ol (PubChem CID 91151253) has the molecular formula C22H40O4 and a molecular weight of 368.56 g/mol. Its IUPAC name is 1-[2-(7-hydroxyhept-2-enyl)-3,5-dimethoxycyclopentyl]oct-1-en-3-ol.
| Compound Name | 1-[2-(7-hydroxyhept-2-enyl)-3,5-dimethoxycyclopentyl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 91151253 |
| Molecular Formula | C22H40O4 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 1-[2-(7-hydroxyhept-2-enyl)-3,5-dimethoxycyclopentyl]oct-1-en-3-ol |
| SMILES | CCCCCC(O)C=CC1C(OC)CC(OC)C1CC=CCCCCO |
| InChI | InChI=1S/C22H40O4/c1-4-5-9-12-18(24)14-15-20-19(13-10-7-6-8-11-16-23)21(25-2)17-22(20)26-3/h7,10,14-15,18-24H,4-6,8-9,11-13,16-17H2,1-3H3 |
| InChIKey | RHEZXJXHNURQNJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|