C21H38O4 — CID 67586033
(1R,2S,4R)-3-[(Z)-7-hydroxyhept-2-enyl]-2-[(E)-8-hydroxyoct-1-enyl]-4-methoxycyclopentan-1-ol (PubChem CID 67586033) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (1R,2S,4R)-3-[(Z)-7-hydroxyhept-2-enyl]-2-[(E)-8-hydroxyoct-1-enyl]-4-methoxycyclopentan-1-ol.
| Compound Name | (1R,2S,4R)-3-[(Z)-7-hydroxyhept-2-enyl]-2-[(E)-8-hydroxyoct-1-enyl]-4-methoxycyclopentan-1-ol |
|---|---|
| PubChem CID | 67586033 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (1R,2S,4R)-3-[(Z)-7-hydroxyhept-2-enyl]-2-[(E)-8-hydroxyoct-1-enyl]-4-methoxycyclopentan-1-ol |
| SMILES | CO[C@@H]1C[C@@H](O)[C@@H](/C=C/CCCCCCO)C1C/C=C\CCCCO |
| InChI | InChI=1S/C21H38O4/c1-25-21-17-20(24)18(13-9-5-2-3-7-11-15-22)19(21)14-10-6-4-8-12-16-23/h6,9-10,13,18-24H,2-5,7-8,11-12,14-17H2,1H3/b10-6-,13-9+/t18-,19?,20+,21+/m0/s1 |
| InChIKey | ZVCVAFMISRTTMU-FBWRPCIOSA-N |
| XLogP | 3.61 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|