C20H34O3 — CID 70114574
(1R,4R)-5-[(Z)-7-hydroxyhept-2-enyl]-4-(8-hydroxyoct-1-enyl)cyclopent-2-en-1-ol (PubChem CID 70114574) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1R,4R)-5-[(Z)-7-hydroxyhept-2-enyl]-4-(8-hydroxyoct-1-enyl)cyclopent-2-en-1-ol.
| Compound Name | (1R,4R)-5-[(Z)-7-hydroxyhept-2-enyl]-4-(8-hydroxyoct-1-enyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 70114574 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1R,4R)-5-[(Z)-7-hydroxyhept-2-enyl]-4-(8-hydroxyoct-1-enyl)cyclopent-2-en-1-ol |
| SMILES | OCCCC/C=C\CC1[C@H](C=CCCCCCCO)C=C[C@H]1O |
| InChI | InChI=1S/C20H34O3/c21-16-10-6-2-1-4-8-12-18-14-15-20(23)19(18)13-9-5-3-7-11-17-22/h5,8-9,12,14-15,18-23H,1-4,6-7,10-11,13,16-17H2/b9-5-,12-8?/t18-,19?,20-/m1/s1 |
| InChIKey | MQUNRWYIFHNPID-CNEDNMBLSA-N |
| XLogP | 3.76 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|