C23H40O4 — CID 56986929
(1R,3S,4S)-2-(7-hydroxyhept-2-enyl)-3-(8-hydroxyoct-1-enyl)-4-prop-2-enoxycyclopentan-1-ol (PubChem CID 56986929) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (1R,3S,4S)-2-(7-hydroxyhept-2-enyl)-3-(8-hydroxyoct-1-enyl)-4-prop-2-enoxycyclopentan-1-ol.
| Compound Name | (1R,3S,4S)-2-(7-hydroxyhept-2-enyl)-3-(8-hydroxyoct-1-enyl)-4-prop-2-enoxycyclopentan-1-ol |
|---|---|
| PubChem CID | 56986929 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (1R,3S,4S)-2-(7-hydroxyhept-2-enyl)-3-(8-hydroxyoct-1-enyl)-4-prop-2-enoxycyclopentan-1-ol |
| SMILES | C=CCO[C@H]1C[C@@H](O)C(CC=CCCCCO)[C@@H]1C=CCCCCCCO |
| InChI | InChI=1S/C23H40O4/c1-2-18-27-23-19-22(26)20(14-10-7-5-9-13-17-25)21(23)15-11-6-3-4-8-12-16-24/h2,7,10-11,15,20-26H,1,3-6,8-9,12-14,16-19H2/t20?,21-,22+,23-/m0/s1 |
| InChIKey | IIIZDBBHHIGBBY-GLCCWIKHSA-N |
| XLogP | 4.16 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|