About 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide
7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide (PubChem CID 123603173) has the molecular formula C14H23NO3
and a molecular weight of 253.34 g/mol. Its IUPAC name is 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide.
Molecular Properties
| Compound Name | 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide |
| PubChem CID | 123603173 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide |
| SMILES | C=CC1C(O)CC(O)C1CC=CCCCC(N)=O |
| InChI | InChI=1S/C14H23NO3/c1-2-10-11(13(17)9-12(10)16)7-5-3-4-6-8-14(15)18/h2-3,5,10-13,16-17H,1,4,6-9H2,(H2,15,18) |
| InChIKey | TVHBCZMHJOZTAZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide?
The IUPAC name of 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide (CID 123603173) is 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide.
What is the SMILES notation for 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide?
The canonical SMILES for 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide is C=CC1C(O)CC(O)C1CC=CCCCC(N)=O.
What is the InChIKey of 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide?
The InChIKey is TVHBCZMHJOZTAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO3/c1-2-10-11(13(17)9-12(10)16)7-5-3-4-6-8-14(15)18/h2-3,5,10-13,16-17H,1,4,6-9H2,(H2,15,18).
What are the key properties of 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide?
7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide has a molecular weight of 253.34 g/mol, XLogP of 1.13, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-ethenyl-3,5-dihydroxycyclopentyl)hept-5-enamide is sourced from PubChem (CID 123603173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).