C17H29BO3 — CID 91807823
CID 91807823 (PubChem CID 91807823) has the molecular formula C17H29BO3 and a molecular weight of 292.23 g/mol.
| Compound Name | CID 91807823 |
|---|---|
| PubChem CID | 91807823 |
| Molecular Formula | C17H29BO3 |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | — |
| SMILES | [B]C(C=C[C@@H]1[C@@H](C/C=C\CCCC)[C@@H](OC)C[C@H]1O)OC |
| InChI | InChI=1S/C17H29BO3/c1-4-5-6-7-8-9-14-13(10-11-17(18)21-3)15(19)12-16(14)20-2/h7-8,10-11,13-17,19H,4-6,9,12H2,1-3H3/b8-7-,11-10?/t13-,14-,15-,16+,17?/m1/s1 |
| InChIKey | VIHZJPWROUEDBI-FKNJWPKSSA-N |
| XLogP | 2.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|