C27H38O3 — CID 23392652
3-[(E)-3-[3-[(E)-3-hydroxyoct-1-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]prop-1-enyl]benzoic acid (PubChem CID 23392652) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is 3-[(E)-3-[3-[(E)-3-hydroxyoct-1-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]prop-1-enyl]benzoic acid.
| Compound Name | 3-[(E)-3-[3-[(E)-3-hydroxyoct-1-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 23392652 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 3-[(E)-3-[3-[(E)-3-hydroxyoct-1-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]prop-1-enyl]benzoic acid |
| SMILES | CCCCCC(O)/C=C/C1CC2CC(C1C/C=C/c1cccc(C(=O)O)c1)C2(C)C |
| InChI | InChI=1S/C27H38O3/c1-4-5-6-12-23(28)15-14-20-17-22-18-25(27(22,2)3)24(20)13-8-10-19-9-7-11-21(16-19)26(29)30/h7-11,14-16,20,22-25,28H,4-6,12-13,17-18H2,1-3H3,(H,29,30)/b10-8+,15-14+ |
| InChIKey | DXQRDISARREXOP-KAXKFVIFSA-N |
| XLogP | 6.58 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|