C21H34N2O2 — CID 67871240
tert-butyl N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]carbamate (PubChem CID 67871240) has the molecular formula C21H34N2O2 and a molecular weight of 346.52 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]carbamate |
|---|---|
| PubChem CID | 67871240 |
| Molecular Formula | C21H34N2O2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | tert-butyl N-[(1R,2R,3S,5S)-3-[(Z)-6-cyanohex-2-enyl]-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1[C@@H](C/C=C\CCCC#N)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C21H34N2O2/c1-20(2,3)25-19(24)23-18-15(11-9-7-6-8-10-12-22)13-16-14-17(18)21(16,4)5/h7,9,15-18H,6,8,10-11,13-14H2,1-5H3,(H,23,24)/b9-7-/t15-,16-,17-,18+/m0/s1 |
| InChIKey | AYXXHNLJWNBSNR-MTUJYXBWSA-N |
| XLogP | 5.20 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|