C26H38N2O5 — CID 102413255
ethyl (2S)-2-[[(1S,2S,3R,5S)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.1]heptane-3-carbonyl]amino]-3-phenylpropanoate (PubChem CID 102413255) has the molecular formula C26H38N2O5 and a molecular weight of 458.60 g/mol. Its IUPAC name is ethyl (2S)-2-[[(1S,2S,3R,5S)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.1]heptane-3-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl (2S)-2-[[(1S,2S,3R,5S)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.1]heptane-3-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 102413255 |
| Molecular Formula | C26H38N2O5 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.28 |
| IUPAC Name | ethyl (2S)-2-[[(1S,2S,3R,5S)-6,6-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[3.1.1]heptane-3-carbonyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H]1C[C@@H]2C[C@H]([C@@H]1NC(=O)OC(C)(C)C)C2(C)C |
| InChI | InChI=1S/C26H38N2O5/c1-7-32-23(30)20(13-16-11-9-8-10-12-16)27-22(29)18-14-17-15-19(26(17,5)6)21(18)28-24(31)33-25(2,3)4/h8-12,17-21H,7,13-15H2,1-6H3,(H,27,29)(H,28,31)/t17-,18-,19-,20+,21-/m1/s1 |
| InChIKey | YDMLKICVYIRROM-SSSFQFABSA-N |
| XLogP | 3.85 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |