C14H24N2O2 — CID 123583183
tert-butyl N-(8-cyanooct-3-en-2-yl)carbamate (PubChem CID 123583183) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is tert-butyl N-(8-cyanooct-3-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(8-cyanooct-3-en-2-yl)carbamate |
|---|---|
| PubChem CID | 123583183 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | tert-butyl N-(8-cyanooct-3-en-2-yl)carbamate |
| SMILES | CC(C=CCCCCC#N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N2O2/c1-12(10-8-6-5-7-9-11-15)16-13(17)18-14(2,3)4/h8,10,12H,5-7,9H2,1-4H3,(H,16,17) |
| InChIKey | ZQFHXHSPNJXVSB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|