C12H16N6O4S2 — CID 69042797
amino 2-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylate (PubChem CID 69042797) has the molecular formula C12H16N6O4S2 and a molecular weight of 372.43 g/mol. Its IUPAC name is amino 2-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | amino 2-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 69042797 |
| Molecular Formula | C12H16N6O4S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | amino 2-[4-(1-methylimidazol-4-yl)sulfonylpiperazin-1-yl]-1,3-thiazole-5-carboxylate |
| SMILES | Cn1cnc(S(=O)(=O)N2CCN(c3ncc(C(=O)ON)s3)CC2)c1 |
| InChI | InChI=1S/C12H16N6O4S2/c1-16-7-10(15-8-16)24(20,21)18-4-2-17(3-5-18)12-14-6-9(23-12)11(19)22-13/h6-8H,2-5,13H2,1H3 |
| InChIKey | IWWXWUSIRDTTPR-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|