C20H26N4O2S — CID 117088638
N-(1-benzylpiperidin-4-yl)-2-morpholin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 117088638) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-2-morpholin-4-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117088638 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C20H26N4O2S/c25-19(18-14-21-20(27-18)24-10-12-26-13-11-24)22-17-6-8-23(9-7-17)15-16-4-2-1-3-5-16/h1-5,14,17H,6-13,15H2,(H,22,25) |
| InChIKey | BZSWPSFAUIATNR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |