C26H29N3O2S — CID 41200888
N-[(3R)-1-benzylpyrrolidin-3-yl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide (PubChem CID 41200888) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is N-[(3R)-1-benzylpyrrolidin-3-yl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide.
| Compound Name | N-[(3R)-1-benzylpyrrolidin-3-yl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 41200888 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | N-[(3R)-1-benzylpyrrolidin-3-yl]-5-morpholin-4-yl-4-phenylthiophene-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCN(Cc2ccccc2)C1)c1cc(-c2ccccc2)c(N2CCOCC2)s1 |
| InChI | InChI=1S/C26H29N3O2S/c30-25(27-22-11-12-28(19-22)18-20-7-3-1-4-8-20)24-17-23(21-9-5-2-6-10-21)26(32-24)29-13-15-31-16-14-29/h1-10,17,22H,11-16,18-19H2,(H,27,30)/t22-/m1/s1 |
| InChIKey | BRQXJJUEGAISOI-JOCHJYFZSA-N |
| XLogP | 4.26 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |