C26H29N3O2S — CID 24513631
(4-benzylpiperazin-1-yl)-(5-morpholin-4-yl-4-phenylthiophen-2-yl)methanone (PubChem CID 24513631) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-(5-morpholin-4-yl-4-phenylthiophen-2-yl)methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-(5-morpholin-4-yl-4-phenylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 24513631 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-(5-morpholin-4-yl-4-phenylthiophen-2-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)c(N2CCOCC2)s1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O2S/c30-25(28-13-11-27(12-14-28)20-21-7-3-1-4-8-21)24-19-23(22-9-5-2-6-10-22)26(32-24)29-15-17-31-18-16-29/h1-10,19H,11-18,20H2 |
| InChIKey | GXHBHKLGTMXEHT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |