C26H35N3OS — CID 20940465
(4-cyclohexylpiperazin-1-yl)-(4-phenyl-5-piperidin-1-ylthiophen-2-yl)methanone (PubChem CID 20940465) has the molecular formula C26H35N3OS and a molecular weight of 437.65 g/mol. Its IUPAC name is (4-cyclohexylpiperazin-1-yl)-(4-phenyl-5-piperidin-1-ylthiophen-2-yl)methanone.
| Compound Name | (4-cyclohexylpiperazin-1-yl)-(4-phenyl-5-piperidin-1-ylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 20940465 |
| Molecular Formula | C26H35N3OS |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (4-cyclohexylpiperazin-1-yl)-(4-phenyl-5-piperidin-1-ylthiophen-2-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)c(N2CCCCC2)s1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C26H35N3OS/c30-25(28-18-16-27(17-19-28)22-12-6-2-7-13-22)24-20-23(21-10-4-1-5-11-21)26(31-24)29-14-8-3-9-15-29/h1,4-5,10-11,20,22H,2-3,6-9,12-19H2 |
| InChIKey | UVRJRBGBRFGWNT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |