C15H21N3O6S — CID 71629955
tert-butyl 4-[(5-nitro-2-pyridinyl)sulfonyl]piperidine-1-carboxylate (PubChem CID 71629955) has the molecular formula C15H21N3O6S and a molecular weight of 371.42 g/mol. Its IUPAC name is tert-butyl 4-[(5-nitro-2-pyridinyl)sulfonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-nitro-2-pyridinyl)sulfonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71629955 |
| Molecular Formula | C15H21N3O6S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | tert-butyl 4-[(5-nitro-2-pyridinyl)sulfonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ccc([N+](=O)[O-])cn2)CC1 |
| InChI | InChI=1S/C15H21N3O6S/c1-15(2,3)24-14(19)17-8-6-12(7-9-17)25(22,23)13-5-4-11(10-16-13)18(20)21/h4-5,10,12H,6-9H2,1-3H3 |
| InChIKey | DCJPVQQAUQWDDY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|