C19H27N3O9S2 — CID 87312260
[(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] 4-carbamoylpiperidine-1-carboxylate (PubChem CID 87312260) has the molecular formula C19H27N3O9S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is [(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] 4-carbamoylpiperidine-1-carboxylate.
| Compound Name | [(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] 4-carbamoylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 87312260 |
| Molecular Formula | C19H27N3O9S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.12 |
| IUPAC Name | [(2-methylpropan-2-yl)oxycarbonyl-(2-methylsulfonylphenyl)sulfonylamino] 4-carbamoylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N(OC(=O)N1CCC(C(N)=O)CC1)S(=O)(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C19H27N3O9S2/c1-19(2,3)30-18(25)22(31-17(24)21-11-9-13(10-12-21)16(20)23)33(28,29)15-8-6-5-7-14(15)32(4,26)27/h5-8,13H,9-12H2,1-4H3,(H2,20,23) |
| InChIKey | VNENZYUROLQZNP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 170.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|