C22H33N3O5 — CID 9425375
tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 9425375) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 9425375 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C22H33N3O5/c1-14-8-7-9-18(15(14)2)29-16(3)19(26)23-24-20(27)17-10-12-25(13-11-17)21(28)30-22(4,5)6/h7-9,16-17H,10-13H2,1-6H3,(H,23,26)(H,24,27)/t16-/m1/s1 |
| InChIKey | XFHJXBBUPXEOFF-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|