About tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate
tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 9425375) has the molecular formula C22H33N3O5
and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate |
| PubChem CID | 9425375 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C22H33N3O5/c1-14-8-7-9-18(15(14)2)29-16(3)19(26)23-24-20(27)17-10-12-25(13-11-17)21(28)30-22(4,5)6/h7-9,16-17H,10-13H2,1-6H3,(H,23,26)(H,24,27)/t16-/m1/s1 |
| InChIKey | XFHJXBBUPXEOFF-MRXNPFEDSA-N |
| XLogP | 2.87 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate (CID 9425375) is tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate is Cc1cccc(O[C@H](C)C(=O)NNC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)c1C.
What is the InChIKey of tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate?
The InChIKey is XFHJXBBUPXEOFF-MRXNPFEDSA-N. The full InChI is InChI=1S/C22H33N3O5/c1-14-8-7-9-18(15(14)2)29-16(3)19(26)23-24-20(27)17-10-12-25(13-11-17)21(28)30-22(4,5)6/h7-9,16-17H,10-13H2,1-6H3,(H,23,26)(H,24,27)/t16-/m1/s1.
What are the key properties of tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate?
tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate has a molecular weight of 419.52 g/mol, XLogP of 2.87, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[[[(2R)-2-(2,3-dimethylphenoxy)propanoyl]amino]carbamoyl]piperidine-1-carboxylate is sourced from PubChem (CID 9425375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).