C16H23ClN4O3 — CID 84819019
tert-butyl 4-[[(6-chloro-2-pyridinyl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 84819019) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is tert-butyl 4-[[(6-chloro-2-pyridinyl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(6-chloro-2-pyridinyl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84819019 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | tert-butyl 4-[[(6-chloro-2-pyridinyl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNc2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C16H23ClN4O3/c1-16(2,3)24-15(23)21-9-7-11(8-10-21)14(22)20-19-13-6-4-5-12(17)18-13/h4-6,11H,7-10H2,1-3H3,(H,18,19)(H,20,22) |
| InChIKey | QKOOLZRXCSVANO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|