C19H24ClN5O4 — CID 71112749
tert-butyl 4-[[(3-chloroindazole-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 71112749) has the molecular formula C19H24ClN5O4 and a molecular weight of 421.89 g/mol. Its IUPAC name is tert-butyl 4-[[(3-chloroindazole-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(3-chloroindazole-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71112749 |
| Molecular Formula | C19H24ClN5O4 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | tert-butyl 4-[[(3-chloroindazole-1-carbonyl)amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)n2nc(Cl)c3ccccc32)CC1 |
| InChI | InChI=1S/C19H24ClN5O4/c1-19(2,3)29-18(28)24-10-8-12(9-11-24)16(26)21-22-17(27)25-14-7-5-4-6-13(14)15(20)23-25/h4-7,12H,8-11H2,1-3H3,(H,21,26)(H,22,27) |
| InChIKey | VJMADLUAMMRHTC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|