C18H27NO5S2 — CID 23594868
tert-butyl 4-[(2-methylsulfonylphenyl)methylsulfinyl]piperidine-1-carboxylate (PubChem CID 23594868) has the molecular formula C18H27NO5S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is tert-butyl 4-[(2-methylsulfonylphenyl)methylsulfinyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-methylsulfonylphenyl)methylsulfinyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23594868 |
| Molecular Formula | C18H27NO5S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | tert-butyl 4-[(2-methylsulfonylphenyl)methylsulfinyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)Cc2ccccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H27NO5S2/c1-18(2,3)24-17(20)19-11-9-15(10-12-19)25(21)13-14-7-5-6-8-16(14)26(4,22)23/h5-8,15H,9-13H2,1-4H3 |
| InChIKey | TWTLTRLZGROWFV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |