C13H12Cl2N2O4S2 — CID 8500668
2,3-dichloro-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide (PubChem CID 8500668) has the molecular formula C13H12Cl2N2O4S2 and a molecular weight of 395.29 g/mol. Its IUPAC name is 2,3-dichloro-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide.
| Compound Name | 2,3-dichloro-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 8500668 |
| Molecular Formula | C13H12Cl2N2O4S2 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 393.96 |
| IUPAC Name | 2,3-dichloro-N'-(4-methylphenyl)sulfonylbenzenesulfonohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNS(=O)(=O)c2cccc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C13H12Cl2N2O4S2/c1-9-5-7-10(8-6-9)22(18,19)16-17-23(20,21)12-4-2-3-11(14)13(12)15/h2-8,16-17H,1H3 |
| InChIKey | WVHHBHCAFYFHFL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|