C23H20Cl2N4O6S2 — CID 4873326
2-[(2,3-dichlorophenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide (PubChem CID 4873326) has the molecular formula C23H20Cl2N4O6S2 and a molecular weight of 583.48 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide.
| Compound Name | 2-[(2,3-dichlorophenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide |
|---|---|
| PubChem CID | 4873326 |
| Molecular Formula | C23H20Cl2N4O6S2 |
| Molecular Weight | 583.48 g/mol |
| Exact Mass | 582.02 |
| IUPAC Name | 2-[(2,3-dichlorophenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)C(=NNc2cccc(Cl)c2Cl)C(=O)NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H20Cl2N4O6S2/c1-14-6-10-16(11-7-14)36(32,33)28-22(30)21(27-26-19-5-3-4-18(24)20(19)25)23(31)29-37(34,35)17-12-8-15(2)9-13-17/h3-13,26H,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | PJZJMNZTDOSIAE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|