C15H12Cl2N4OS — CID 6223201
(2Z)-3-amino-2-[(2,3-dichlorophenyl)hydrazinylidene]-N-phenyl-3-sulfanylidenepropanamide (PubChem CID 6223201) has the molecular formula C15H12Cl2N4OS and a molecular weight of 367.26 g/mol. Its IUPAC name is (2Z)-3-amino-2-[(2,3-dichlorophenyl)hydrazinylidene]-N-phenyl-3-sulfanylidenepropanamide.
| Compound Name | (2Z)-3-amino-2-[(2,3-dichlorophenyl)hydrazinylidene]-N-phenyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 6223201 |
| Molecular Formula | C15H12Cl2N4OS |
| Molecular Weight | 367.26 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | (2Z)-3-amino-2-[(2,3-dichlorophenyl)hydrazinylidene]-N-phenyl-3-sulfanylidenepropanamide |
| SMILES | NC(=S)/C(=N\Nc1cccc(Cl)c1Cl)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H12Cl2N4OS/c16-10-7-4-8-11(12(10)17)20-21-13(14(18)23)15(22)19-9-5-2-1-3-6-9/h1-8,20H,(H2,18,23)(H,19,22)/b21-13+ |
| InChIKey | FAWSGNHDGIXBFF-FYJGNVAPSA-N |
| XLogP | 3.69 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.26 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|