C22H18N4O2S2 — CID 44665432
2-[2-[(2-anilino-2-oxoethanethioyl)amino]anilino]-N-phenyl-2-sulfanylideneacetamide (PubChem CID 44665432) has the molecular formula C22H18N4O2S2 and a molecular weight of 434.55 g/mol. Its IUPAC name is 2-[2-[(2-anilino-2-oxoethanethioyl)amino]anilino]-N-phenyl-2-sulfanylideneacetamide.
| Compound Name | 2-[2-[(2-anilino-2-oxoethanethioyl)amino]anilino]-N-phenyl-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 44665432 |
| Molecular Formula | C22H18N4O2S2 |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-[2-[(2-anilino-2-oxoethanethioyl)amino]anilino]-N-phenyl-2-sulfanylideneacetamide |
| SMILES | O=C(Nc1ccccc1)C(=S)Nc1ccccc1NC(=S)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H18N4O2S2/c27-19(23-15-9-3-1-4-10-15)21(29)25-17-13-7-8-14-18(17)26-22(30)20(28)24-16-11-5-2-6-12-16/h1-14H,(H,23,27)(H,24,28)(H,25,29)(H,26,30) |
| InChIKey | KCDSRKZVKKTERK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|