C14H13N3O3S2 — CID 25049375
2-anilino-N-(4-sulfamoylphenyl)-2-sulfanylideneacetamide (PubChem CID 25049375) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-anilino-N-(4-sulfamoylphenyl)-2-sulfanylideneacetamide.
| Compound Name | 2-anilino-N-(4-sulfamoylphenyl)-2-sulfanylideneacetamide |
|---|---|
| PubChem CID | 25049375 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-anilino-N-(4-sulfamoylphenyl)-2-sulfanylideneacetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)C(=S)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C14H13N3O3S2/c15-22(19,20)12-8-6-11(7-9-12)16-13(18)14(21)17-10-4-2-1-3-5-10/h1-9H,(H,16,18)(H,17,21)(H2,15,19,20) |
| InChIKey | QHLOGIKGMUOFGV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|