C15H15N3O4S — CID 108508706
N'-methyl-N'-phenyl-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508706) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-methyl-N'-phenyl-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508706 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(4-sulfamoylphenyl)oxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc(S(N)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C15H15N3O4S/c1-18(12-5-3-2-4-6-12)15(20)14(19)17-11-7-9-13(10-8-11)23(16,21)22/h2-10H,1H3,(H,17,19)(H2,16,21,22) |
| InChIKey | MGMAMWJZIXEHPO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|