C13H19N3O4S — CID 108508773
N'-butyl-N'-methyl-N-(4-sulfamoylphenyl)oxamide (PubChem CID 108508773) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is N'-butyl-N'-methyl-N-(4-sulfamoylphenyl)oxamide.
| Compound Name | N'-butyl-N'-methyl-N-(4-sulfamoylphenyl)oxamide |
|---|---|
| PubChem CID | 108508773 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | N'-butyl-N'-methyl-N-(4-sulfamoylphenyl)oxamide |
| SMILES | CCCCN(C)C(=O)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H19N3O4S/c1-3-4-9-16(2)13(18)12(17)15-10-5-7-11(8-6-10)21(14,19)20/h5-8H,3-4,9H2,1-2H3,(H,15,17)(H2,14,19,20) |
| InChIKey | LBVJNMUPMOUEKT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|