C20H23N3O2 — CID 108520940
N'-methyl-N'-phenyl-N-(4-piperidin-1-ylphenyl)oxamide (PubChem CID 108520940) has the molecular formula C20H23N3O2 and a molecular weight of 337.42 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-(4-piperidin-1-ylphenyl)oxamide.
| Compound Name | N'-methyl-N'-phenyl-N-(4-piperidin-1-ylphenyl)oxamide |
|---|---|
| PubChem CID | 108520940 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | N'-methyl-N'-phenyl-N-(4-piperidin-1-ylphenyl)oxamide |
| SMILES | CN(C(=O)C(=O)Nc1ccc(N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23N3O2/c1-22(17-8-4-2-5-9-17)20(25)19(24)21-16-10-12-18(13-11-16)23-14-6-3-7-15-23/h2,4-5,8-13H,3,6-7,14-15H2,1H3,(H,21,24) |
| InChIKey | DCZIHSCUJUMBCA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|