C26H25N5O3S — CID 118514034
1-[4-[N-methyl-3-(3-sulfamoylanilino)anilino]phenyl]-3-phenylurea (PubChem CID 118514034) has the molecular formula C26H25N5O3S and a molecular weight of 487.59 g/mol. Its IUPAC name is 1-[4-[N-methyl-3-(3-sulfamoylanilino)anilino]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[N-methyl-3-(3-sulfamoylanilino)anilino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 118514034 |
| Molecular Formula | C26H25N5O3S |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 1-[4-[N-methyl-3-(3-sulfamoylanilino)anilino]phenyl]-3-phenylurea |
| SMILES | CN(c1ccc(NC(=O)Nc2ccccc2)cc1)c1cccc(Nc2cccc(S(N)(=O)=O)c2)c1 |
| InChI | InChI=1S/C26H25N5O3S/c1-31(23-15-13-20(14-16-23)30-26(32)29-19-7-3-2-4-8-19)24-11-5-9-21(17-24)28-22-10-6-12-25(18-22)35(27,33)34/h2-18,28H,1H3,(H2,27,33,34)(H2,29,30,32) |
| InChIKey | PBQOJQNZKDNHSG-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |