C24H24N4O7S2 — CID 4873322
2-[(3-methoxyphenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide (PubChem CID 4873322) has the molecular formula C24H24N4O7S2 and a molecular weight of 544.61 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide.
| Compound Name | 2-[(3-methoxyphenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide |
|---|---|
| PubChem CID | 4873322 |
| Molecular Formula | C24H24N4O7S2 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | 2-[(3-methoxyphenyl)hydrazinylidene]-N,N'-bis-(4-methylphenyl)sulfonylpropanediamide |
| SMILES | COc1cccc(NN=C(C(=O)NS(=O)(=O)c2ccc(C)cc2)C(=O)NS(=O)(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H24N4O7S2/c1-16-7-11-20(12-8-16)36(31,32)27-23(29)22(26-25-18-5-4-6-19(15-18)35-3)24(30)28-37(33,34)21-13-9-17(2)10-14-21/h4-15,25H,1-3H3,(H,27,29)(H,28,30) |
| InChIKey | KIXZEQDZCHFDAO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 160.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|