C22H18Cl2N2O6S2 — CID 19742783
[(E)-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]amino] N-(4-methylphenyl)sulfonylcarbamate (PubChem CID 19742783) has the molecular formula C22H18Cl2N2O6S2 and a molecular weight of 541.43 g/mol. Its IUPAC name is [(E)-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]amino] N-(4-methylphenyl)sulfonylcarbamate.
| Compound Name | [(E)-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]amino] N-(4-methylphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 19742783 |
| Molecular Formula | C22H18Cl2N2O6S2 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.00 |
| IUPAC Name | [(E)-[(2,6-dichlorophenyl)-(4-methylphenyl)sulfonylmethylidene]amino] N-(4-methylphenyl)sulfonylcarbamate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)O/N=C(\c2c(Cl)cccc2Cl)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O6S2/c1-14-6-10-16(11-7-14)33(28,29)21(20-18(23)4-3-5-19(20)24)25-32-22(27)26-34(30,31)17-12-8-15(2)9-13-17/h3-13H,1-2H3,(H,26,27)/b25-21+ |
| InChIKey | UZFWQVOFDKOXAI-NJNXFGOHSA-N |
| XLogP | 4.86 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|